C10H9NO2 — CID 10942968
(3S)-3-phenyl-2,3-dihydro-1,4-oxazin-6-one (PubChem CID 10942968) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is (3S)-3-phenyl-2,3-dihydro-1,4-oxazin-6-one.
| Compound Name | (3S)-3-phenyl-2,3-dihydro-1,4-oxazin-6-one |
|---|---|
| PubChem CID | 10942968 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | (3S)-3-phenyl-2,3-dihydro-1,4-oxazin-6-one |
| SMILES | O=C1C=N[C@@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C10H9NO2/c12-10-6-11-9(7-13-10)8-4-2-1-3-5-8/h1-6,9H,7H2/t9-/m1/s1 |
| InChIKey | DINGSFSTMYUIAU-SECBINFHSA-N |
| XLogP | 1.36 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |