C22H33IN6O3 — CID 109430290
N-[3-[[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide;hydroiodide (PubChem CID 109430290) has the molecular formula C22H33IN6O3 and a molecular weight of 556.45 g/mol. Its IUPAC name is N-[3-[[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide;hydroiodide.
| Compound Name | N-[3-[[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 109430290 |
| Molecular Formula | C22H33IN6O3 |
| Molecular Weight | 556.45 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | N-[3-[[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)CCN2CCOCC2)c1)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C22H32N6O3.HI/c1-16-17(2)31-21(26-16)15-25-22(23-3)24-14-18-5-4-6-19(13-18)27-20(29)7-8-28-9-11-30-12-10-28;/h4-6,13H,7-12,14-15H2,1-3H3,(H,27,29)(H2,23,24,25);1H |
| InChIKey | NPQLHMSBNWQKIB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|