C24H42IN5O2 — CID 111173771
N-[3-[[[N'-methyl-N-(6-methylheptan-2-yl)carbamimidoyl]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide;hydroiodide (PubChem CID 111173771) has the molecular formula C24H42IN5O2 and a molecular weight of 559.54 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-(6-methylheptan-2-yl)carbamimidoyl]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide;hydroiodide.
| Compound Name | N-[3-[[[N'-methyl-N-(6-methylheptan-2-yl)carbamimidoyl]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111173771 |
| Molecular Formula | C24H42IN5O2 |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | N-[3-[[[N'-methyl-N-(6-methylheptan-2-yl)carbamimidoyl]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)CCN2CCOCC2)c1)NC(C)CCCC(C)C.I |
| InChI | InChI=1S/C24H41N5O2.HI/c1-19(2)7-5-8-20(3)27-24(25-4)26-18-21-9-6-10-22(17-21)28-23(30)11-12-29-13-15-31-16-14-29;/h6,9-10,17,19-20H,5,7-8,11-16,18H2,1-4H3,(H,28,30)(H2,25,26,27);1H |
| InChIKey | MWUMVHYBDFTAAG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|