C23H38N6O2 — CID 111262239
N-[3-[[[N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide (PubChem CID 111262239) has the molecular formula C23H38N6O2 and a molecular weight of 430.60 g/mol. Its IUPAC name is N-[3-[[[N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide.
| Compound Name | N-[3-[[[N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 111262239 |
| Molecular Formula | C23H38N6O2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | N-[3-[[[N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-morpholin-4-ylpropanamide |
| SMILES | CCN1CCCC1CN/C(=N\C)NCc1cccc(NC(=O)CCN2CCOCC2)c1 |
| InChI | InChI=1S/C23H38N6O2/c1-3-29-10-5-8-21(29)18-26-23(24-2)25-17-19-6-4-7-20(16-19)27-22(30)9-11-28-12-14-31-15-13-28/h4,6-7,16,21H,3,5,8-15,17-18H2,1-2H3,(H,27,30)(H2,24,25,26) |
| InChIKey | LOHYOUNOOWJTHR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|