C18H27N9O — CID 109432961
N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperazine-1-carboximidamide (PubChem CID 109432961) has the molecular formula C18H27N9O and a molecular weight of 385.48 g/mol. Its IUPAC name is N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109432961 |
| Molecular Formula | C18H27N9O |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCC2)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C18H27N9O/c1-3-19-18(20-11-16-23-22-15-6-4-5-7-27(15)16)25-8-9-26(17(28)13-25)14-10-21-24(2)12-14/h10,12H,3-9,11,13H2,1-2H3,(H,19,20) |
| InChIKey | GMKZUEHVSNZKSD-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|