C20H27N7O3 — CID 109435569
4-methoxy-N-[2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]ethyl]benzamide (PubChem CID 109435569) has the molecular formula C20H27N7O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 4-methoxy-N-[2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 109435569 |
| Molecular Formula | C20H27N7O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 4-methoxy-N-[2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(\NCCNC(=O)c1ccc(OC)cc1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C20H27N7O3/c1-21-20(23-9-8-22-19(29)15-4-6-17(30-3)7-5-15)26-10-11-27(18(28)14-26)16-12-24-25(2)13-16/h4-7,12-13H,8-11,14H2,1-3H3,(H,21,23)(H,22,29) |
| InChIKey | QJRXLJFZCDYCJP-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 104.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|