C13H20O2 — CID 10943699
(4R,6R)-4-ethenyl-2,2,5,5-tetramethyl-6-prop-2-ynyl-1,3-dioxane (PubChem CID 10943699) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (4R,6R)-4-ethenyl-2,2,5,5-tetramethyl-6-prop-2-ynyl-1,3-dioxane.
| Compound Name | (4R,6R)-4-ethenyl-2,2,5,5-tetramethyl-6-prop-2-ynyl-1,3-dioxane |
|---|---|
| PubChem CID | 10943699 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (4R,6R)-4-ethenyl-2,2,5,5-tetramethyl-6-prop-2-ynyl-1,3-dioxane |
| SMILES | C#CC[C@H]1OC(C)(C)O[C@H](C=C)C1(C)C |
| InChI | InChI=1S/C13H20O2/c1-7-9-11-12(3,4)10(8-2)14-13(5,6)15-11/h1,8,10-11H,2,9H2,3-6H3/t10-,11-/m1/s1 |
| InChIKey | UHBDVFLWXFHTKJ-GHMZBOCLSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|