About (4R,6S)-4-tert-butyl-6-ethenyl-1,3-dioxane
(4R,6S)-4-tert-butyl-6-ethenyl-1,3-dioxane (PubChem CID 10855928) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (4R,6S)-4-tert-butyl-6-ethenyl-1,3-dioxane.
Molecular Properties
| Compound Name | (4R,6S)-4-tert-butyl-6-ethenyl-1,3-dioxane |
| PubChem CID | 10855928 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (4R,6S)-4-tert-butyl-6-ethenyl-1,3-dioxane |
| SMILES | C=C[C@@H]1C[C@H](C(C)(C)C)OCO1 |
| InChI | InChI=1S/C10H18O2/c1-5-8-6-9(10(2,3)4)12-7-11-8/h5,8-9H,1,6-7H2,2-4H3/t8-,9-/m1/s1 |
| InChIKey | OFPIKGWGTJPDPK-RKDXNWHRSA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R,6S)-4-tert-butyl-6-ethenyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,6S)-4-tert-butyl-6-ethenyl-1,3-dioxane?
The IUPAC name of (4R,6S)-4-tert-butyl-6-ethenyl-1,3-dioxane (CID 10855928) is (4R,6S)-4-tert-butyl-6-ethenyl-1,3-dioxane.
What is the SMILES notation for (4R,6S)-4-tert-butyl-6-ethenyl-1,3-dioxane?
The canonical SMILES for (4R,6S)-4-tert-butyl-6-ethenyl-1,3-dioxane is C=C[C@@H]1C[C@H](C(C)(C)C)OCO1.
What is the InChIKey of (4R,6S)-4-tert-butyl-6-ethenyl-1,3-dioxane?
The InChIKey is OFPIKGWGTJPDPK-RKDXNWHRSA-N. The full InChI is InChI=1S/C10H18O2/c1-5-8-6-9(10(2,3)4)12-7-11-8/h5,8-9H,1,6-7H2,2-4H3/t8-,9-/m1/s1.
What are the key properties of (4R,6S)-4-tert-butyl-6-ethenyl-1,3-dioxane?
(4R,6S)-4-tert-butyl-6-ethenyl-1,3-dioxane has a molecular weight of 170.25 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,6S)-4-tert-butyl-6-ethenyl-1,3-dioxane is sourced from PubChem (CID 10855928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).