C10H16O3 — CID 13868629
4-Tert-butyl-6-ethenyl-1,3-dioxan-2-one (PubChem CID 13868629) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 4-tert-butyl-6-ethenyl-1,3-dioxan-2-one.
| Compound Name | 4-Tert-butyl-6-ethenyl-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 13868629 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 4-tert-butyl-6-ethenyl-1,3-dioxan-2-one |
| SMILES | CC(C)(C)C1CC(OC(=O)O1)C=C |
| InChI | InChI=1S/C10H16O3/c1-5-7-6-8(10(2,3)4)13-9(11)12-7/h5,7-8H,1,6H2,2-4H3 |
| InChIKey | JIRKIMVWUXXKBT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | 215 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|