C21H34ClN3O3S — CID 109437239
2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine (PubChem CID 109437239) has the molecular formula C21H34ClN3O3S and a molecular weight of 444.04 g/mol. Its IUPAC name is 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine.
| Compound Name | 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 109437239 |
| Molecular Formula | C21H34ClN3O3S |
| Molecular Weight | 444.04 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine |
| SMILES | CCN/C(=N\Cc1cc(Cl)c(OCC)c(OC)c1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C21H34ClN3O3S/c1-5-23-21(25-16-9-8-10-17(13-16)29(26)7-3)24-14-15-11-18(22)20(28-6-2)19(12-15)27-4/h11-12,16-17H,5-10,13-14H2,1-4H3,(H2,23,24,25) |
| InChIKey | YBCKUQJGRONYRZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.04 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|