C20H31F2N3O3S — CID 109441037
2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine (PubChem CID 109441037) has the molecular formula C20H31F2N3O3S and a molecular weight of 431.55 g/mol. Its IUPAC name is 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine.
| Compound Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 109441037 |
| Molecular Formula | C20H31F2N3O3S |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC(F)F)c1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C20H31F2N3O3S/c1-4-23-20(25-15-7-6-8-16(12-15)29(26)5-2)24-13-14-9-10-17(27-3)18(11-14)28-19(21)22/h9-11,15-16,19H,4-8,12-13H2,1-3H3,(H2,23,24,25) |
| InChIKey | FHSLSFNCPRPAEO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|