C15H31N3O3S2 — CID 109437433
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-methyl-2-methylsulfonylpropyl)guanidine (PubChem CID 109437433) has the molecular formula C15H31N3O3S2 and a molecular weight of 365.57 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-methyl-2-methylsulfonylpropyl)guanidine.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-methyl-2-methylsulfonylpropyl)guanidine |
|---|---|
| PubChem CID | 109437433 |
| Molecular Formula | C15H31N3O3S2 |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-methyl-2-methylsulfonylpropyl)guanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCC(C)(C)S(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H31N3O3S2/c1-6-22(19)13-9-7-8-12(10-13)18-14(16-4)17-11-15(2,3)23(5,20)21/h12-13H,6-11H2,1-5H3,(H2,16,17,18) |
| InChIKey | PHCIVAXXFAWFIT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|