C20H32BrN3OS — CID 109441057
1-[2-(2-bromophenyl)-2-methylpropyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine (PubChem CID 109441057) has the molecular formula C20H32BrN3OS and a molecular weight of 442.47 g/mol. Its IUPAC name is 1-[2-(2-bromophenyl)-2-methylpropyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine.
| Compound Name | 1-[2-(2-bromophenyl)-2-methylpropyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109441057 |
| Molecular Formula | C20H32BrN3OS |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 1-[2-(2-bromophenyl)-2-methylpropyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCC(C)(C)c2ccccc2Br)C1 |
| InChI | InChI=1S/C20H32BrN3OS/c1-5-26(25)16-10-8-9-15(13-16)24-19(22-4)23-14-20(2,3)17-11-6-7-12-18(17)21/h6-7,11-12,15-16H,5,8-10,13-14H2,1-4H3,(H2,22,23,24) |
| InChIKey | YAMQDFCMNKPIEJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|