C21H34IN3O3S — CID 109440194
1-[2-(1,3-benzodioxol-5-yl)-2-methylpropyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide (PubChem CID 109440194) has the molecular formula C21H34IN3O3S and a molecular weight of 535.49 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)-2-methylpropyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)-2-methylpropyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109440194 |
| Molecular Formula | C21H34IN3O3S |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)-2-methylpropyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCC(C)(C)c2ccc3c(c2)OCO3)C1.I |
| InChI | InChI=1S/C21H33N3O3S.HI/c1-5-28(25)17-8-6-7-16(12-17)24-20(22-4)23-13-21(2,3)15-9-10-18-19(11-15)27-14-26-18;/h9-11,16-17H,5-8,12-14H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | SWTSEOIIRLMXRM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|