C16H28N6O3S — CID 109439109
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(4-nitropyrazol-1-yl)ethyl]guanidine (PubChem CID 109439109) has the molecular formula C16H28N6O3S and a molecular weight of 384.51 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(4-nitropyrazol-1-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(4-nitropyrazol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 109439109 |
| Molecular Formula | C16H28N6O3S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(4-nitropyrazol-1-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCn1cc([N+](=O)[O-])cn1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C16H28N6O3S/c1-3-17-16(18-8-9-21-12-14(11-19-21)22(23)24)20-13-6-5-7-15(10-13)26(25)4-2/h11-13,15H,3-10H2,1-2H3,(H2,17,18,20) |
| InChIKey | WOARCUDKEJOZAY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|