C24H40N4O2S — CID 109439381
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[3-[(2-methylmorpholin-4-yl)methyl]phenyl]methyl]guanidine (PubChem CID 109439381) has the molecular formula C24H40N4O2S and a molecular weight of 448.68 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[3-[(2-methylmorpholin-4-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[3-[(2-methylmorpholin-4-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109439381 |
| Molecular Formula | C24H40N4O2S |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[3-[(2-methylmorpholin-4-yl)methyl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(CN2CCOC(C)C2)c1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C24H40N4O2S/c1-4-25-24(27-22-10-7-11-23(15-22)31(29)5-2)26-16-20-8-6-9-21(14-20)18-28-12-13-30-19(3)17-28/h6,8-9,14,19,22-23H,4-5,7,10-13,15-18H2,1-3H3,(H2,25,26,27) |
| InChIKey | OUMHYWKPQTVPDM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|