C21H35IN4S — CID 109441562
N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide (PubChem CID 109441562) has the molecular formula C21H35IN4S and a molecular weight of 502.51 g/mol. Its IUPAC name is N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109441562 |
| Molecular Formula | C21H35IN4S |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC1CCCN(C)C1c1cccs1)N1CC2CCCCC2C1.I |
| InChI | InChI=1S/C21H34N4S.HI/c1-22-21(25-14-17-7-3-4-8-18(17)15-25)23-13-16-9-5-11-24(2)20(16)19-10-6-12-26-19;/h6,10,12,16-18,20H,3-5,7-9,11,13-15H2,1-2H3,(H,22,23);1H |
| InChIKey | UZZQQUCCEWHZRM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|