C15H26N6 — CID 109443003
N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide (PubChem CID 109443003) has the molecular formula C15H26N6 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide.
| Compound Name | N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 109443003 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
| SMILES | CCN/C(=N\Cc1ncnn1C)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C15H26N6/c1-3-16-15(17-8-14-18-11-19-20(14)2)21-9-12-6-4-5-7-13(12)10-21/h11-13H,3-10H2,1-2H3,(H,16,17) |
| InChIKey | DKFBIWDSNNEGOW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|