C24H38N4O3 — CID 109446873
N-[4-[[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]methyl]phenyl]butanamide (PubChem CID 109446873) has the molecular formula C24H38N4O3 and a molecular weight of 430.59 g/mol. Its IUPAC name is N-[4-[[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]methyl]phenyl]butanamide.
| Compound Name | N-[4-[[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 109446873 |
| Molecular Formula | C24H38N4O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | N-[4-[[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]methyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(CN/C(=N/C)N2CCC(OCC3CCCCO3)CC2)cc1 |
| InChI | InChI=1S/C24H38N4O3/c1-3-6-23(29)27-20-10-8-19(9-11-20)17-26-24(25-2)28-14-12-21(13-15-28)31-18-22-7-4-5-16-30-22/h8-11,21-22H,3-7,12-18H2,1-2H3,(H,25,26)(H,27,29) |
| InChIKey | WRBJYPXBAJCZFK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|