C22H35N5O3 — CID 109448869
3-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide (PubChem CID 109448869) has the molecular formula C22H35N5O3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 3-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 109448869 |
| Molecular Formula | C22H35N5O3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | 3-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
| SMILES | C/N=C(\NCCC(=O)Nc1ccc(C)cn1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C22H35N5O3/c1-17-6-7-20(25-15-17)26-21(28)8-11-24-22(23-2)27-12-9-18(10-13-27)30-16-19-5-3-4-14-29-19/h6-7,15,18-19H,3-5,8-14,16H2,1-2H3,(H,23,24)(H,25,26,28) |
| InChIKey | PBIGHYITBUIALC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|