C25H43IN4O2 — CID 109448692
N-ethyl-N'-[4-(N-methylanilino)butyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109448692) has the molecular formula C25H43IN4O2 and a molecular weight of 558.55 g/mol. Its IUPAC name is N-ethyl-N'-[4-(N-methylanilino)butyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[4-(N-methylanilino)butyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109448692 |
| Molecular Formula | C25H43IN4O2 |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | N-ethyl-N'-[4-(N-methylanilino)butyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCN(C)c1ccccc1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C25H42N4O2.HI/c1-3-26-25(27-16-8-9-17-28(2)22-11-5-4-6-12-22)29-18-14-23(15-19-29)31-21-24-13-7-10-20-30-24;/h4-6,11-12,23-24H,3,7-10,13-21H2,1-2H3,(H,26,27);1H |
| InChIKey | LXSNFGSGKRITNN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|