C25H41N3O3 — CID 109449485
N-ethyl-4-(oxan-2-ylmethoxy)-N'-[3-(1-phenylethoxy)propyl]piperidine-1-carboximidamide (PubChem CID 109449485) has the molecular formula C25H41N3O3 and a molecular weight of 431.62 g/mol. Its IUPAC name is N-ethyl-4-(oxan-2-ylmethoxy)-N'-[3-(1-phenylethoxy)propyl]piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-(oxan-2-ylmethoxy)-N'-[3-(1-phenylethoxy)propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109449485 |
| Molecular Formula | C25H41N3O3 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.31 |
| IUPAC Name | N-ethyl-4-(oxan-2-ylmethoxy)-N'-[3-(1-phenylethoxy)propyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCOC(C)c1ccccc1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C25H41N3O3/c1-3-26-25(27-15-9-19-29-21(2)22-10-5-4-6-11-22)28-16-13-23(14-17-28)31-20-24-12-7-8-18-30-24/h4-6,10-11,21,23-24H,3,7-9,12-20H2,1-2H3,(H,26,27) |
| InChIKey | RGCZCPPUFTUQLQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|