C18H24O — CID 10945056
(5S)-5-benzyl-4-prop-2-enylocta-1,7-dien-4-ol (PubChem CID 10945056) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is (5S)-5-benzyl-4-prop-2-enylocta-1,7-dien-4-ol.
| Compound Name | (5S)-5-benzyl-4-prop-2-enylocta-1,7-dien-4-ol |
|---|---|
| PubChem CID | 10945056 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | (5S)-5-benzyl-4-prop-2-enylocta-1,7-dien-4-ol |
| SMILES | C=CC[C@@H](Cc1ccccc1)C(O)(CC=C)CC=C |
| InChI | InChI=1S/C18H24O/c1-4-10-17(15-16-11-8-7-9-12-16)18(19,13-5-2)14-6-3/h4-9,11-12,17,19H,1-3,10,13-15H2/t17-/m0/s1 |
| InChIKey | YRRALJSTASHOCO-KRWDZBQOSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|