C21H27NO — CID 178185677
(2R,3S)-2-(N-benzylanilino)-3-ethylhex-5-en-3-ol (PubChem CID 178185677) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is (2R,3S)-2-(N-benzylanilino)-3-ethylhex-5-en-3-ol.
| Compound Name | (2R,3S)-2-(N-benzylanilino)-3-ethylhex-5-en-3-ol |
|---|---|
| PubChem CID | 178185677 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (2R,3S)-2-(N-benzylanilino)-3-ethylhex-5-en-3-ol |
| SMILES | C=CC[C@@](O)(CC)[C@@H](C)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO/c1-4-16-21(23,5-2)18(3)22(20-14-10-7-11-15-20)17-19-12-8-6-9-13-19/h4,6-15,18,23H,1,5,16-17H2,2-3H3/t18-,21+/m1/s1 |
| InChIKey | ZYWXVRICAOZRQN-NQIIRXRSSA-N |
| XLogP | 4.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|