C15H23NO — CID 178185639
(2R,3S)-2-(N-ethylanilino)-3-methylhex-5-en-3-ol (PubChem CID 178185639) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is (2R,3S)-2-(N-ethylanilino)-3-methylhex-5-en-3-ol.
| Compound Name | (2R,3S)-2-(N-ethylanilino)-3-methylhex-5-en-3-ol |
|---|---|
| PubChem CID | 178185639 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (2R,3S)-2-(N-ethylanilino)-3-methylhex-5-en-3-ol |
| SMILES | C=CC[C@](C)(O)[C@@H](C)N(CC)c1ccccc1 |
| InChI | InChI=1S/C15H23NO/c1-5-12-15(4,17)13(3)16(6-2)14-10-8-7-9-11-14/h5,7-11,13,17H,1,6,12H2,2-4H3/t13-,15+/m1/s1 |
| InChIKey | WFFPLGDCPZHHOM-HIFRSBDPSA-N |
| XLogP | 3.23 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|