C18H29NO3 — CID 178185645
(2R,3S)-2-[N-(4-hydroxybutyl)-4-methoxyanilino]-3-methylhex-5-en-3-ol (PubChem CID 178185645) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is (2R,3S)-2-[N-(4-hydroxybutyl)-4-methoxyanilino]-3-methylhex-5-en-3-ol.
| Compound Name | (2R,3S)-2-[N-(4-hydroxybutyl)-4-methoxyanilino]-3-methylhex-5-en-3-ol |
|---|---|
| PubChem CID | 178185645 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | (2R,3S)-2-[N-(4-hydroxybutyl)-4-methoxyanilino]-3-methylhex-5-en-3-ol |
| SMILES | C=CC[C@](C)(O)[C@@H](C)N(CCCCO)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H29NO3/c1-5-12-18(3,21)15(2)19(13-6-7-14-20)16-8-10-17(22-4)11-9-16/h5,8-11,15,20-21H,1,6-7,12-14H2,2-4H3/t15-,18+/m1/s1 |
| InChIKey | NAKNEPNXCRKJKL-QAPCUYQASA-N |
| XLogP | 2.99 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|