C16H29N5 — CID 109451901
N',2,2,3,3-pentamethyl-N-[3-(4-methylpyrazol-1-yl)propyl]azetidine-1-carboximidamide (PubChem CID 109451901) has the molecular formula C16H29N5 and a molecular weight of 291.44 g/mol. Its IUPAC name is N',2,2,3,3-pentamethyl-N-[3-(4-methylpyrazol-1-yl)propyl]azetidine-1-carboximidamide.
| Compound Name | N',2,2,3,3-pentamethyl-N-[3-(4-methylpyrazol-1-yl)propyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109451901 |
| Molecular Formula | C16H29N5 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | N',2,2,3,3-pentamethyl-N-[3-(4-methylpyrazol-1-yl)propyl]azetidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCn1cc(C)cn1)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C16H29N5/c1-13-10-19-20(11-13)9-7-8-18-14(17-6)21-12-15(2,3)16(21,4)5/h10-11H,7-9,12H2,1-6H3,(H,17,18) |
| InChIKey | FGZQNDIRAILYOD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|