C12H26IN3S — CID 109452640
N',2,2,3,3-pentamethyl-N-(2-methylsulfanylethyl)azetidine-1-carboximidamide;hydroiodide (PubChem CID 109452640) has the molecular formula C12H26IN3S and a molecular weight of 371.33 g/mol. Its IUPAC name is N',2,2,3,3-pentamethyl-N-(2-methylsulfanylethyl)azetidine-1-carboximidamide;hydroiodide.
| Compound Name | N',2,2,3,3-pentamethyl-N-(2-methylsulfanylethyl)azetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109452640 |
| Molecular Formula | C12H26IN3S |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N',2,2,3,3-pentamethyl-N-(2-methylsulfanylethyl)azetidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCSC)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C12H25N3S.HI/c1-11(2)9-15(12(11,3)4)10(13-5)14-7-8-16-6;/h7-9H2,1-6H3,(H,13,14);1H |
| InChIKey | SYFXKUYPIWCMFT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|