C16H26O3 — CID 10945386
methyl (1S,2R,5S,8S,9R)-9-hydroxy-2,10,10-trimethyltricyclo[6.3.0.01,5]undecane-6-carboxylate (PubChem CID 10945386) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is methyl (1S,2R,5S,8S,9R)-9-hydroxy-2,10,10-trimethyltricyclo[6.3.0.01,5]undecane-6-carboxylate.
| Compound Name | methyl (1S,2R,5S,8S,9R)-9-hydroxy-2,10,10-trimethyltricyclo[6.3.0.01,5]undecane-6-carboxylate |
|---|---|
| PubChem CID | 10945386 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | methyl (1S,2R,5S,8S,9R)-9-hydroxy-2,10,10-trimethyltricyclo[6.3.0.01,5]undecane-6-carboxylate |
| SMILES | COC(=O)C1C[C@@H]2[C@@H](O)C(C)(C)C[C@@]23[C@H](C)CC[C@@H]13 |
| InChI | InChI=1S/C16H26O3/c1-9-5-6-11-10(14(18)19-4)7-12-13(17)15(2,3)8-16(9,11)12/h9-13,17H,5-8H2,1-4H3/t9-,10?,11+,12-,13-,16+/m1/s1 |
| InChIKey | IPJSCUCWUKBIRM-QCUNPJFASA-N |
| XLogP | 2.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |