C21H27FN4O2S — CID 109456178
3-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine (PubChem CID 109456178) has the molecular formula C21H27FN4O2S and a molecular weight of 418.54 g/mol. Its IUPAC name is 3-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine.
| Compound Name | 3-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 109456178 |
| Molecular Formula | C21H27FN4O2S |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 3-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\Cc1oc2ccc(F)cc2c1C)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C21H27FN4O2S/c1-6-23-21(26(4)11-16-12-29-20(25-16)14(3)27-5)24-10-19-13(2)17-9-15(22)7-8-18(17)28-19/h7-9,12,14H,6,10-11H2,1-5H3,(H,23,24) |
| InChIKey | GDRGSCZBEDFAHQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|