C23H42IN5O — CID 109457563
1-(1-benzyl-2-methylpiperidin-4-yl)-3-[4-(dimethylamino)-2-ethoxybutyl]-2-methylguanidine;hydroiodide (PubChem CID 109457563) has the molecular formula C23H42IN5O and a molecular weight of 531.53 g/mol. Its IUPAC name is 1-(1-benzyl-2-methylpiperidin-4-yl)-3-[4-(dimethylamino)-2-ethoxybutyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-3-[4-(dimethylamino)-2-ethoxybutyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109457563 |
| Molecular Formula | C23H42IN5O |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-3-[4-(dimethylamino)-2-ethoxybutyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOC(CCN(C)C)CN/C(=N\C)NC1CCN(Cc2ccccc2)C(C)C1.I |
| InChI | InChI=1S/C23H41N5O.HI/c1-6-29-22(13-14-27(4)5)17-25-23(24-3)26-21-12-15-28(19(2)16-21)18-20-10-8-7-9-11-20;/h7-11,19,21-22H,6,12-18H2,1-5H3,(H2,24,25,26);1H |
| InChIKey | VXJZZTZLIWVGBW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|