C22H34IN5O2S — CID 109460915
1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 109460915) has the molecular formula C22H34IN5O2S and a molecular weight of 559.52 g/mol. Its IUPAC name is 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109460915 |
| Molecular Formula | C22H34IN5O2S |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1csc(N2CCCC2)n1)Nc1cccc(OCCCOC)c1.I |
| InChI | InChI=1S/C22H33N5O2S.HI/c1-3-23-21(25-18-8-6-9-20(16-18)29-15-7-14-28-2)24-11-10-19-17-30-22(26-19)27-12-4-5-13-27;/h6,8-9,16-17H,3-5,7,10-15H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | MALNJTIKOSHCJE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|