C22H35IN6O3 — CID 109461921
1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide (PubChem CID 109461921) has the molecular formula C22H35IN6O3 and a molecular weight of 558.47 g/mol. Its IUPAC name is 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109461921 |
| Molecular Formula | C22H35IN6O3 |
| Molecular Weight | 558.47 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1nc2n(c1=O)CCCC2)Nc1cccc(OCCCOC)c1.I |
| InChI | InChI=1S/C22H34N6O3.HI/c1-3-23-21(25-18-9-6-10-19(17-18)31-16-8-15-30-2)24-12-7-14-28-22(29)27-13-5-4-11-20(27)26-28;/h6,9-10,17H,3-5,7-8,11-16H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | NAWWJOMIPTTYGO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|