C22H26ClN5O3 — CID 109461074
1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[3-(3-methoxypropoxy)phenyl]-2-methylguanidine (PubChem CID 109461074) has the molecular formula C22H26ClN5O3 and a molecular weight of 443.94 g/mol. Its IUPAC name is 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[3-(3-methoxypropoxy)phenyl]-2-methylguanidine.
| Compound Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[3-(3-methoxypropoxy)phenyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109461074 |
| Molecular Formula | C22H26ClN5O3 |
| Molecular Weight | 443.94 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[3-(3-methoxypropoxy)phenyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1nc(-c2ccc(Cl)cc2)no1)Nc1cccc(OCCCOC)c1 |
| InChI | InChI=1S/C22H26ClN5O3/c1-24-22(26-18-5-3-6-19(15-18)30-14-4-13-29-2)25-12-11-20-27-21(28-31-20)16-7-9-17(23)10-8-16/h3,5-10,15H,4,11-14H2,1-2H3,(H2,24,25,26) |
| InChIKey | VGFWKDGLJVFUBA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.94 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|