C21H31N7O3 — CID 109465376
tert-butyl 3-[[N-ethyl-N'-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109465376) has the molecular formula C21H31N7O3 and a molecular weight of 429.53 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109465376 |
| Molecular Formula | C21H31N7O3 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1nc(-c2ccc(OC)cc2)n[nH]1)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H31N7O3/c1-6-22-19(24-15-12-28(13-15)20(29)31-21(2,3)4)23-11-17-25-18(27-26-17)14-7-9-16(30-5)10-8-14/h7-10,15H,6,11-13H2,1-5H3,(H2,22,23,24)(H,25,26,27) |
| InChIKey | VIWZRXIKDXOGIU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|