C18H26F2N4O3 — CID 109465652
tert-butyl 3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109465652) has the molecular formula C18H26F2N4O3 and a molecular weight of 384.43 g/mol. Its IUPAC name is tert-butyl 3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109465652 |
| Molecular Formula | C18H26F2N4O3 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | tert-butyl 3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | C/N=C(\NCc1ccccc1OC(F)F)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H26F2N4O3/c1-18(2,3)27-17(25)24-10-13(11-24)23-16(21-4)22-9-12-7-5-6-8-14(12)26-15(19)20/h5-8,13,15H,9-11H2,1-4H3,(H2,21,22,23) |
| InChIKey | MHMDLIITQLQEMO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|