C20H27N5O2S — CID 109466088
tert-butyl 3-[[N'-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109466088) has the molecular formula C20H27N5O2S and a molecular weight of 401.54 g/mol. Its IUPAC name is tert-butyl 3-[[N'-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N'-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109466088 |
| Molecular Formula | C20H27N5O2S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | tert-butyl 3-[[N'-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | C/N=C(\NCc1csc(-c2ccccc2)n1)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H27N5O2S/c1-20(2,3)27-19(26)25-11-16(12-25)24-18(21-4)22-10-15-13-28-17(23-15)14-8-6-5-7-9-14/h5-9,13,16H,10-12H2,1-4H3,(H2,21,22,24) |
| InChIKey | ZZXNOSKPRXZYJC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|