C18H26IN5OS — CID 111385639
N-tert-butyl-2-[[N'-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111385639) has the molecular formula C18H26IN5OS and a molecular weight of 487.41 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111385639 |
| Molecular Formula | C18H26IN5OS |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCc1csc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C18H25N5OS.HI/c1-18(2,3)23-15(24)11-21-17(19-4)20-10-14-12-25-16(22-14)13-8-6-5-7-9-13;/h5-9,12H,10-11H2,1-4H3,(H,23,24)(H2,19,20,21);1H |
| InChIKey | ADELJCBQIMZDRL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|