C20H24N4S2 — CID 111581432
2-methyl-1-(2-methyl-2-thiophen-2-ylpropyl)-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 111581432) has the molecular formula C20H24N4S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-thiophen-2-ylpropyl)-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-(2-methyl-2-thiophen-2-ylpropyl)-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111581432 |
| Molecular Formula | C20H24N4S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-thiophen-2-ylpropyl)-3-[(2-phenyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1csc(-c2ccccc2)n1)NCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C20H24N4S2/c1-20(2,17-10-7-11-25-17)14-23-19(21-3)22-12-16-13-26-18(24-16)15-8-5-4-6-9-15/h4-11,13H,12,14H2,1-3H3,(H2,21,22,23) |
| InChIKey | PCTOTMPPRVNDIF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|