C19H28IN5OS — CID 111384967
N-tert-butyl-2-[[N-ethyl-N'-[(2-phenyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111384967) has the molecular formula C19H28IN5OS and a molecular weight of 501.44 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-ethyl-N'-[(2-phenyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N-ethyl-N'-[(2-phenyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111384967 |
| Molecular Formula | C19H28IN5OS |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | N-tert-butyl-2-[[N-ethyl-N'-[(2-phenyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1csc(-c2ccccc2)n1)NCC(=O)NC(C)(C)C.I |
| InChI | InChI=1S/C19H27N5OS.HI/c1-5-20-18(22-12-16(25)24-19(2,3)4)21-11-15-13-26-17(23-15)14-9-7-6-8-10-14;/h6-10,13H,5,11-12H2,1-4H3,(H,24,25)(H2,20,21,22);1H |
| InChIKey | KTZQJKBEWIRSAU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|