C23H28IN5OS — CID 111873046
4-[[[ethylamino-[(2-phenyl-1,3-thiazol-4-yl)methylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111873046) has the molecular formula C23H28IN5OS and a molecular weight of 549.48 g/mol. Its IUPAC name is 4-[[[ethylamino-[(2-phenyl-1,3-thiazol-4-yl)methylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 4-[[[ethylamino-[(2-phenyl-1,3-thiazol-4-yl)methylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111873046 |
| Molecular Formula | C23H28IN5OS |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | 4-[[[ethylamino-[(2-phenyl-1,3-thiazol-4-yl)methylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)NCc1csc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C23H27N5OS.HI/c1-4-24-23(25-14-17-10-12-19(13-11-17)22(29)28(2)3)26-15-20-16-30-21(27-20)18-8-6-5-7-9-18;/h5-13,16H,4,14-15H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | DMODVJSKUPYYKY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|