C17H25IN6O2 — CID 111874056
4-[[[ethylamino-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111874056) has the molecular formula C17H25IN6O2 and a molecular weight of 472.33 g/mol. Its IUPAC name is 4-[[[ethylamino-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 4-[[[ethylamino-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111874056 |
| Molecular Formula | C17H25IN6O2 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 4-[[[ethylamino-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)NCc1nc(C)no1.I |
| InChI | InChI=1S/C17H24N6O2.HI/c1-5-18-17(20-11-15-21-12(2)22-25-15)19-10-13-6-8-14(9-7-13)16(24)23(3)4;/h6-9H,5,10-11H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | USQOBAFWTFCNDM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|