C20H29IN4O2 — CID 111580568
4-[[[[(2,5-dimethylfuran-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111580568) has the molecular formula C20H29IN4O2 and a molecular weight of 484.38 g/mol. Its IUPAC name is 4-[[[[(2,5-dimethylfuran-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 4-[[[[(2,5-dimethylfuran-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111580568 |
| Molecular Formula | C20H29IN4O2 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 4-[[[[(2,5-dimethylfuran-3-yl)methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)NCc1cc(C)oc1C.I |
| InChI | InChI=1S/C20H28N4O2.HI/c1-6-21-20(23-13-18-11-14(2)26-15(18)3)22-12-16-7-9-17(10-8-16)19(25)24(4)5;/h7-11H,6,12-13H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | QLMPFGYJRCKMAX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|