C22H32IN5O3S — CID 111873376
4-[[[[[2-(dimethylsulfamoyl)phenyl]methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111873376) has the molecular formula C22H32IN5O3S and a molecular weight of 573.50 g/mol. Its IUPAC name is 4-[[[[[2-(dimethylsulfamoyl)phenyl]methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 4-[[[[[2-(dimethylsulfamoyl)phenyl]methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111873376 |
| Molecular Formula | C22H32IN5O3S |
| Molecular Weight | 573.50 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | 4-[[[[[2-(dimethylsulfamoyl)phenyl]methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)NCc1ccccc1S(=O)(=O)N(C)C.I |
| InChI | InChI=1S/C22H31N5O3S.HI/c1-6-23-22(24-15-17-11-13-18(14-12-17)21(28)26(2)3)25-16-19-9-7-8-10-20(19)31(29,30)27(4)5;/h7-14H,6,15-16H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | ODNBVRYNJKYRHO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|