C12H23F3N4O — CID 109471443
N-butan-2-yl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide (PubChem CID 109471443) has the molecular formula C12H23F3N4O and a molecular weight of 296.34 g/mol. Its IUPAC name is N-butan-2-yl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide.
| Compound Name | N-butan-2-yl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 109471443 |
| Molecular Formula | C12H23F3N4O |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | N-butan-2-yl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide |
| SMILES | CCC(C)NC(=O)CCN/C(=N\C)NCCC(F)(F)F |
| InChI | InChI=1S/C12H23F3N4O/c1-4-9(2)19-10(20)5-7-17-11(16-3)18-8-6-12(13,14)15/h9H,4-8H2,1-3H3,(H,19,20)(H2,16,17,18) |
| InChIKey | WXBURNJLCZZRDF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|