C10H20F3N3O2 — CID 109471697
1-[2-(2-methoxyethoxy)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109471697) has the molecular formula C10H20F3N3O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 1-[2-(2-methoxyethoxy)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[2-(2-methoxyethoxy)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109471697 |
| Molecular Formula | C10H20F3N3O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 1-[2-(2-methoxyethoxy)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCOCCOC)NCCC(F)(F)F |
| InChI | InChI=1S/C10H20F3N3O2/c1-14-9(15-4-3-10(11,12)13)16-5-6-18-8-7-17-2/h3-8H2,1-2H3,(H2,14,15,16) |
| InChIKey | LNRWGVIYMWIPIL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|