C17H31F3N4 — CID 109471773
2-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109471773) has the molecular formula C17H31F3N4 and a molecular weight of 348.46 g/mol. Its IUPAC name is 2-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109471773 |
| Molecular Formula | C17H31F3N4 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 2-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C=CCN(CC=C)C(C/N=C(\NCC)NCCC(F)(F)F)C(C)C |
| InChI | InChI=1S/C17H31F3N4/c1-6-11-24(12-7-2)15(14(4)5)13-23-16(21-8-3)22-10-9-17(18,19)20/h6-7,14-15H,1-2,8-13H2,3-5H3,(H2,21,22,23) |
| InChIKey | SWUFQINGXMYGCT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|