C12H21F6IN4 — CID 109471838
2-methyl-1-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109471838) has the molecular formula C12H21F6IN4 and a molecular weight of 462.22 g/mol. Its IUPAC name is 2-methyl-1-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109471838 |
| Molecular Formula | C12H21F6IN4 |
| Molecular Weight | 462.22 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 2-methyl-1-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C12H20F6N4.HI/c1-19-10(20-4-3-11(13,14)15)21-6-9-2-5-22(7-9)8-12(16,17)18;/h9H,2-8H2,1H3,(H2,19,20,21);1H |
| InChIKey | RKBYYQRALAJZGQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|