C11H21F3IN3OS — CID 109472084
1-ethyl-2-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109472084) has the molecular formula C11H21F3IN3OS and a molecular weight of 427.27 g/mol. Its IUPAC name is 1-ethyl-2-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109472084 |
| Molecular Formula | C11H21F3IN3OS |
| Molecular Weight | 427.27 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 1-ethyl-2-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(O)CCSC1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C11H20F3N3OS.HI/c1-2-15-9(16-5-3-11(12,13)14)17-7-10(18)4-6-19-8-10;/h18H,2-8H2,1H3,(H2,15,16,17);1H |
| InChIKey | BCORUGYXQDBDCM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|