C18H27NO2S — CID 10947212
benzyl N-[(1S,2S)-2-tert-butylsulfanylcyclohexyl]carbamate (PubChem CID 10947212) has the molecular formula C18H27NO2S and a molecular weight of 321.49 g/mol. Its IUPAC name is benzyl N-[(1S,2S)-2-tert-butylsulfanylcyclohexyl]carbamate.
| Compound Name | benzyl N-[(1S,2S)-2-tert-butylsulfanylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 10947212 |
| Molecular Formula | C18H27NO2S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | benzyl N-[(1S,2S)-2-tert-butylsulfanylcyclohexyl]carbamate |
| SMILES | CC(C)(C)S[C@H]1CCCC[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H27NO2S/c1-18(2,3)22-16-12-8-7-11-15(16)19-17(20)21-13-14-9-5-4-6-10-14/h4-6,9-10,15-16H,7-8,11-13H2,1-3H3,(H,19,20)/t15-,16-/m0/s1 |
| InChIKey | UPZQAYUNWUOHJG-HOTGVXAUSA-N |
| XLogP | 4.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |